C17H17N3O3 — CID 100595132
(2S)-4-(2-phenylacetyl)-2,3-dihydro-1,4-benzoxazine-2-carbohydrazide (PubChem CID 100595132) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is (2S)-4-(2-phenylacetyl)-2,3-dihydro-1,4-benzoxazine-2-carbohydrazide.
| Compound Name | (2S)-4-(2-phenylacetyl)-2,3-dihydro-1,4-benzoxazine-2-carbohydrazide |
|---|---|
| PubChem CID | 100595132 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2S)-4-(2-phenylacetyl)-2,3-dihydro-1,4-benzoxazine-2-carbohydrazide |
| SMILES | NNC(=O)[C@@H]1CN(C(=O)Cc2ccccc2)c2ccccc2O1 |
| InChI | InChI=1S/C17H17N3O3/c18-19-17(22)15-11-20(13-8-4-5-9-14(13)23-15)16(21)10-12-6-2-1-3-7-12/h1-9,15H,10-11,18H2,(H,19,22)/t15-/m0/s1 |
| InChIKey | PQDCVTUYXXGOTO-HNNXBMFYSA-N |
| XLogP | 1.01 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|