C31H38N4O7S — CID 100595365
(2R)-N-butyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100595365) has the molecular formula C31H38N4O7S and a molecular weight of 610.73 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100595365 |
| Molecular Formula | C31H38N4O7S |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CN(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C31H38N4O7S/c1-5-6-17-32-31(37)28(19-24-12-8-7-9-13-24)33(21-25-14-10-11-23(2)18-25)30(36)22-34(43(4,40)41)27-20-26(35(38)39)15-16-29(27)42-3/h7-16,18,20,28H,5-6,17,19,21-22H2,1-4H3,(H,32,37)/t28-/m1/s1 |
| InChIKey | SBGAWSSPWJRZGB-MUUNZHRXSA-N |
| XLogP | 4.23 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|