C10H13NO3S — CID 10059630
5,6,7,8-tetrahydronaphthalen-2-yl sulfamate (PubChem CID 10059630) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalen-2-yl sulfamate.
| Compound Name | 5,6,7,8-tetrahydronaphthalen-2-yl sulfamate |
|---|---|
| PubChem CID | 10059630 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalen-2-yl sulfamate |
| SMILES | NS(=O)(=O)Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H13NO3S/c11-15(12,13)14-10-6-5-8-3-1-2-4-9(8)7-10/h5-7H,1-4H2,(H2,11,12,13) |
| InChIKey | UZQBSKJYCKNUPW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |