C17H21NO2 — CID 100597098
2-(2,4-dimethylphenyl)-N-[3-(furan-2-yl)propyl]acetamide (PubChem CID 100597098) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-[3-(furan-2-yl)propyl]acetamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-[3-(furan-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 100597098 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-[3-(furan-2-yl)propyl]acetamide |
| SMILES | Cc1ccc(CC(=O)NCCCc2ccco2)c(C)c1 |
| InChI | InChI=1S/C17H21NO2/c1-13-7-8-15(14(2)11-13)12-17(19)18-9-3-5-16-6-4-10-20-16/h4,6-8,10-11H,3,5,9,12H2,1-2H3,(H,18,19) |
| InChIKey | SOFRZMAEVXXNPR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|