C10H18ClNOSi — CID 10059798
(3aS)-1-chloro-3,3-dimethyl-1-prop-2-enyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazasilole (PubChem CID 10059798) has the molecular formula C10H18ClNOSi and a molecular weight of 231.80 g/mol. Its IUPAC name is (3aS)-1-chloro-3,3-dimethyl-1-prop-2-enyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazasilole.
| Compound Name | (3aS)-1-chloro-3,3-dimethyl-1-prop-2-enyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazasilole |
|---|---|
| PubChem CID | 10059798 |
| Molecular Formula | C10H18ClNOSi |
| Molecular Weight | 231.80 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | (3aS)-1-chloro-3,3-dimethyl-1-prop-2-enyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazasilole |
| SMILES | C=CC[Si]1(Cl)OC(C)(C)[C@@H]2CCCN21 |
| InChI | InChI=1S/C10H18ClNOSi/c1-4-8-14(11)12-7-5-6-9(12)10(2,3)13-14/h4,9H,1,5-8H2,2-3H3/t9-,14?/m0/s1 |
| InChIKey | LFOIOHCBRVXFEZ-CUVJYRNJSA-N |
| XLogP | 2.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.80 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|