C12H16N4O — CID 10059827
(10S)-5-ethyl-6-methyl-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3,6,8-trien-2-one (PubChem CID 10059827) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is (10S)-5-ethyl-6-methyl-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3,6,8-trien-2-one.
| Compound Name | (10S)-5-ethyl-6-methyl-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3,6,8-trien-2-one |
|---|---|
| PubChem CID | 10059827 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (10S)-5-ethyl-6-methyl-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3,6,8-trien-2-one |
| SMILES | CCn1nc2c(c1C)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C12H16N4O/c1-3-16-8(2)10-11(14-16)12(17)15-6-4-5-9(15)7-13-10/h7,9H,3-6H2,1-2H3/t9-/m0/s1 |
| InChIKey | RZGTWNSOMRBOCU-VIFPVBQESA-N |
| XLogP | 1.53 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |