C15H23N3O2S — CID 100598336
(5S)-2-butyl-5-(2,4-dimethoxyphenyl)-5-methyl-1,2,4-triazolidine-3-thione (PubChem CID 100598336) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is (5S)-2-butyl-5-(2,4-dimethoxyphenyl)-5-methyl-1,2,4-triazolidine-3-thione.
| Compound Name | (5S)-2-butyl-5-(2,4-dimethoxyphenyl)-5-methyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 100598336 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (5S)-2-butyl-5-(2,4-dimethoxyphenyl)-5-methyl-1,2,4-triazolidine-3-thione |
| SMILES | CCCCN1N[C@@](C)(c2ccc(OC)cc2OC)NC1=S |
| InChI | InChI=1S/C15H23N3O2S/c1-5-6-9-18-14(21)16-15(2,17-18)12-8-7-11(19-3)10-13(12)20-4/h7-8,10,17H,5-6,9H2,1-4H3,(H,16,21)/t15-/m0/s1 |
| InChIKey | AGIPOHWFQREQJY-HNNXBMFYSA-N |
| XLogP | 2.37 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|