C24H25N3O4S — CID 100600620
N-(4-carbamoylphenyl)-4-[(2,6-dimethyl-N-methylsulfonylanilino)methyl]benzamide (PubChem CID 100600620) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-4-[(2,6-dimethyl-N-methylsulfonylanilino)methyl]benzamide.
| Compound Name | N-(4-carbamoylphenyl)-4-[(2,6-dimethyl-N-methylsulfonylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 100600620 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | N-(4-carbamoylphenyl)-4-[(2,6-dimethyl-N-methylsulfonylanilino)methyl]benzamide |
| SMILES | Cc1cccc(C)c1N(Cc1ccc(C(=O)Nc2ccc(C(N)=O)cc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C24H25N3O4S/c1-16-5-4-6-17(2)22(16)27(32(3,30)31)15-18-7-9-20(10-8-18)24(29)26-21-13-11-19(12-14-21)23(25)28/h4-14H,15H2,1-3H3,(H2,25,28)(H,26,29) |
| InChIKey | FUNIZDRWDIFASM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |