C22H19FN4O — CID 100600926
(1'S,4'S,6S)-3-(4-fluorophenyl)spiro[7H-[1,2,4]triazino[2,3-c]quinazoline-6,2'-bicyclo[2.2.1]heptane]-2-one (PubChem CID 100600926) has the molecular formula C22H19FN4O and a molecular weight of 374.42 g/mol. Its IUPAC name is (1'S,4'S,6S)-3-(4-fluorophenyl)spiro[7H-[1,2,4]triazino[2,3-c]quinazoline-6,2'-bicyclo[2.2.1]heptane]-2-one.
| Compound Name | (1'S,4'S,6S)-3-(4-fluorophenyl)spiro[7H-[1,2,4]triazino[2,3-c]quinazoline-6,2'-bicyclo[2.2.1]heptane]-2-one |
|---|---|
| PubChem CID | 100600926 |
| Molecular Formula | C22H19FN4O |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (1'S,4'S,6S)-3-(4-fluorophenyl)spiro[7H-[1,2,4]triazino[2,3-c]quinazoline-6,2'-bicyclo[2.2.1]heptane]-2-one |
| SMILES | O=c1nc2n(nc1-c1ccc(F)cc1)[C@]1(C[C@H]3CC[C@H]1C3)Nc1ccccc1-2 |
| InChI | InChI=1S/C22H19FN4O/c23-16-9-6-14(7-10-16)19-21(28)24-20-17-3-1-2-4-18(17)25-22(27(20)26-19)12-13-5-8-15(22)11-13/h1-4,6-7,9-10,13,15,25H,5,8,11-12H2/t13-,15-,22-/m0/s1 |
| InChIKey | POGRFTBWHIVXBM-XUHFEKCNSA-N |
| XLogP | 4.01 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |