C25H34N2O5S — CID 100602099
4-(4-ethoxy-N-methylsulfonylanilino)-N-[(4-phenyloxan-4-yl)methyl]butanamide (PubChem CID 100602099) has the molecular formula C25H34N2O5S and a molecular weight of 474.62 g/mol. Its IUPAC name is 4-(4-ethoxy-N-methylsulfonylanilino)-N-[(4-phenyloxan-4-yl)methyl]butanamide.
| Compound Name | 4-(4-ethoxy-N-methylsulfonylanilino)-N-[(4-phenyloxan-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 100602099 |
| Molecular Formula | C25H34N2O5S |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 4-(4-ethoxy-N-methylsulfonylanilino)-N-[(4-phenyloxan-4-yl)methyl]butanamide |
| SMILES | CCOc1ccc(N(CCCC(=O)NCC2(c3ccccc3)CCOCC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H34N2O5S/c1-3-32-23-13-11-22(12-14-23)27(33(2,29)30)17-7-10-24(28)26-20-25(15-18-31-19-16-25)21-8-5-4-6-9-21/h4-6,8-9,11-14H,3,7,10,15-20H2,1-2H3,(H,26,28) |
| InChIKey | VDDMSZUNBGHLNC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |