About 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate
3-(1H-imidazol-5-yl)propyl N-phenylcarbamate (PubChem CID 10060425) has the molecular formula C13H15N3O2
and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate.
Molecular Properties
| Compound Name | 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate |
| PubChem CID | 10060425 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCCc1cnc[nH]1 |
| InChI | InChI=1S/C13H15N3O2/c17-13(16-11-5-2-1-3-6-11)18-8-4-7-12-9-14-10-15-12/h1-3,5-6,9-10H,4,7-8H2,(H,14,15)(H,16,17) |
| InChIKey | LPMVGZWIQPTEJR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate?
The IUPAC name of 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate (CID 10060425) is 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate.
What is the SMILES notation for 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate?
The canonical SMILES for 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate is O=C(Nc1ccccc1)OCCCc1cnc[nH]1.
What is the InChIKey of 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate?
The InChIKey is LPMVGZWIQPTEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2/c17-13(16-11-5-2-1-3-6-11)18-8-4-7-12-9-14-10-15-12/h1-3,5-6,9-10H,4,7-8H2,(H,14,15)(H,16,17).
What are the key properties of 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate?
3-(1H-imidazol-5-yl)propyl N-phenylcarbamate has a molecular weight of 245.28 g/mol, XLogP of 2.59, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazol-5-yl)propyl N-phenylcarbamate is sourced from PubChem (CID 10060425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).