C24H23F3N2O4S — CID 100604334
2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 100604334) has the molecular formula C24H23F3N2O4S and a molecular weight of 492.52 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 100604334 |
| Molecular Formula | C24H23F3N2O4S |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCc2cccc(C(F)(F)F)c2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23F3N2O4S/c1-2-33-21-13-11-20(12-14-21)29(34(31,32)22-9-4-3-5-10-22)17-23(30)28-16-18-7-6-8-19(15-18)24(25,26)27/h3-15H,2,16-17H2,1H3,(H,28,30) |
| InChIKey | IQJNDRTZLCYAGB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |