About (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide
(3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide (PubChem CID 100605032) has the molecular formula C17H29N3O2S
and a molecular weight of 339.50 g/mol. Its IUPAC name is (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide |
| PubChem CID | 100605032 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)N[C@H](C)[C@@H](c2ccccc2)N(C)C)C1 |
| InChI | InChI=1S/C17H29N3O2S/c1-14-9-8-12-20(13-14)23(21,22)18-15(2)17(19(3)4)16-10-6-5-7-11-16/h5-7,10-11,14-15,17-18H,8-9,12-13H2,1-4H3/t14-,15-,17+/m1/s1 |
| InChIKey | JMOGKUASPOITCC-INMHGKMJSA-N |
| XLogP | 2.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide?
The IUPAC name of (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide (CID 100605032) is (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide.
What is the SMILES notation for (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide?
The canonical SMILES for (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide is C[C@@H]1CCCN(S(=O)(=O)N[C@H](C)[C@@H](c2ccccc2)N(C)C)C1.
What is the InChIKey of (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide?
The InChIKey is JMOGKUASPOITCC-INMHGKMJSA-N. The full InChI is InChI=1S/C17H29N3O2S/c1-14-9-8-12-20(13-14)23(21,22)18-15(2)17(19(3)4)16-10-6-5-7-11-16/h5-7,10-11,14-15,17-18H,8-9,12-13H2,1-4H3/t14-,15-,17+/m1/s1.
What are the key properties of (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide?
(3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide has a molecular weight of 339.50 g/mol, XLogP of 2.24, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-[(1R,2R)-1-(dimethylamino)-1-phenylpropan-2-yl]-3-methylpiperidine-1-sulfonamide is sourced from PubChem (CID 100605032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).