About 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine
2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 10060509) has the molecular formula C8H8Cl2N4O
and a molecular weight of 247.09 g/mol. Its IUPAC name is 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine.
Molecular Properties
| Compound Name | 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine |
| PubChem CID | 10060509 |
| Molecular Formula | C8H8Cl2N4O |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | N/C(=N/N=C/c1c(Cl)cccc1Cl)NO |
| InChI | InChI=1S/C8H8Cl2N4O/c9-6-2-1-3-7(10)5(6)4-12-13-8(11)14-15/h1-4,15H,(H3,11,13,14)/b12-4+ |
| InChIKey | QKIQJNNDIWGVEH-UUILKARUSA-N |
| XLogP | 1.62 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine?
The IUPAC name of 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine (CID 10060509) is 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine.
What is the SMILES notation for 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine?
The canonical SMILES for 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine is N/C(=N/N=C/c1c(Cl)cccc1Cl)NO.
What is the InChIKey of 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine?
The InChIKey is QKIQJNNDIWGVEH-UUILKARUSA-N. The full InChI is InChI=1S/C8H8Cl2N4O/c9-6-2-1-3-7(10)5(6)4-12-13-8(11)14-15/h1-4,15H,(H3,11,13,14)/b12-4+.
What are the key properties of 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine?
2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine has a molecular weight of 247.09 g/mol, XLogP of 1.62, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine is sourced from PubChem (CID 10060509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).