C17H17Cl2NO — CID 100605551
3-(2,4-dichlorophenyl)-N-(2,3-dimethylphenyl)propanamide (PubChem CID 100605551) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-(2,3-dimethylphenyl)propanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-(2,3-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 100605551 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-(2,3-dimethylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CCc2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C17H17Cl2NO/c1-11-4-3-5-16(12(11)2)20-17(21)9-7-13-6-8-14(18)10-15(13)19/h3-6,8,10H,7,9H2,1-2H3,(H,20,21) |
| InChIKey | CVOBVGNFIMDZIU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |