C26H20Cl2N4O2S — CID 1006057
(8R,8aR)-6-amino-8-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile (PubChem CID 1006057) has the molecular formula C26H20Cl2N4O2S and a molecular weight of 523.45 g/mol. Its IUPAC name is (8R,8aR)-6-amino-8-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aR)-6-amino-8-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 1006057 |
| Molecular Formula | C26H20Cl2N4O2S |
| Molecular Weight | 523.45 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | (8R,8aR)-6-amino-8-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile |
| SMILES | COc1cc([C@H]2[C@H]3CSCC=C3C(C#N)=C(N)C2(C#N)C#N)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H20Cl2N4O2S/c1-33-23-9-16(3-5-22(23)34-11-15-2-4-20(27)21(28)8-15)24-19-12-35-7-6-17(19)18(10-29)25(32)26(24,13-30)14-31/h2-6,8-9,19,24H,7,11-12,32H2,1H3/t19-,24-/m0/s1 |
| InChIKey | FIDZTXFDXXOGBB-CYFREDJKSA-N |
| XLogP | 5.74 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|