C34H36ClN3O4S — CID 100607049
(2S)-2-[[2-[N-(benzenesulfonyl)anilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100607049) has the molecular formula C34H36ClN3O4S and a molecular weight of 618.20 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)anilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)anilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100607049 |
| Molecular Formula | C34H36ClN3O4S |
| Molecular Weight | 618.20 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)anilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CN(c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H36ClN3O4S/c1-2-3-23-36-34(40)32(24-27-15-7-4-8-16-27)37(25-28-17-13-14-22-31(28)35)33(39)26-38(29-18-9-5-10-19-29)43(41,42)30-20-11-6-12-21-30/h4-22,32H,2-3,23-26H2,1H3,(H,36,40)/t32-/m0/s1 |
| InChIKey | LVYDSNVNLKJEOS-YTTGMZPUSA-N |
| XLogP | 6.09 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.20 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|