C14H18O4 — CID 10060709
ethyl (2R)-2-deuterio-2-[(1S,4R,5S,6R)-10-oxo-11-oxatricyclo[4.3.2.01,5]undec-8-en-4-yl]acetate (PubChem CID 10060709) has the molecular formula C14H18O4 and a molecular weight of 251.30 g/mol. Its IUPAC name is ethyl (2R)-2-deuterio-2-[(1S,4R,5S,6R)-10-oxo-11-oxatricyclo[4.3.2.01,5]undec-8-en-4-yl]acetate.
| Compound Name | ethyl (2R)-2-deuterio-2-[(1S,4R,5S,6R)-10-oxo-11-oxatricyclo[4.3.2.01,5]undec-8-en-4-yl]acetate |
|---|---|
| PubChem CID | 10060709 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | ethyl (2R)-2-deuterio-2-[(1S,4R,5S,6R)-10-oxo-11-oxatricyclo[4.3.2.01,5]undec-8-en-4-yl]acetate |
| SMILES | [2H][C@@H](C(=O)OCC)[C@H]1CC[C@@]23C=CC[C@@H](OC2=O)[C@@H]13 |
| InChI | InChI=1S/C14H18O4/c1-2-17-11(15)8-9-5-7-14-6-3-4-10(12(9)14)18-13(14)16/h3,6,9-10,12H,2,4-5,7-8H2,1H3/t9-,10-,12-,14-/m1/s1/i8D/t8-,9-,10-,12-,14- |
| InChIKey | FBYSFAFBAQLVNW-FAZUPXJASA-N |
| XLogP | 1.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|