C14H14N2S — CID 100608244
(7S)-8-thia-2,11-diazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaene (PubChem CID 100608244) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is (7S)-8-thia-2,11-diazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaene.
| Compound Name | (7S)-8-thia-2,11-diazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaene |
|---|---|
| PubChem CID | 100608244 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (7S)-8-thia-2,11-diazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaene |
| SMILES | c1ccc2c(c1)CN1CCS[C@H]1c1cccn1-2 |
| InChI | InChI=1S/C14H14N2S/c1-2-5-12-11(4-1)10-15-8-9-17-14(15)13-6-3-7-16(12)13/h1-7,14H,8-10H2/t14-/m0/s1 |
| InChIKey | ATLLPWOKOGJSMX-AWEZNQCLSA-N |
| XLogP | 3.04 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |