About 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one
8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one (PubChem CID 10060912) has the molecular formula C15H13NO3
and a molecular weight of 255.27 g/mol. Its IUPAC name is 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one.
Molecular Properties
| Compound Name | 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one |
| PubChem CID | 10060912 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one |
| SMILES | Cc1c(O)ccc2c1oc(=O)c1c(C)c(N)ccc12 |
| InChI | InChI=1S/C15H13NO3/c1-7-11(16)5-3-9-10-4-6-12(17)8(2)14(10)19-15(18)13(7)9/h3-6,17H,16H2,1-2H3 |
| InChIKey | RDSPSMPVXHZZAS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one?
The IUPAC name of 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one (CID 10060912) is 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one.
What is the SMILES notation for 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one?
The canonical SMILES for 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one is Cc1c(O)ccc2c1oc(=O)c1c(C)c(N)ccc12.
What is the InChIKey of 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one?
The InChIKey is RDSPSMPVXHZZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c1-7-11(16)5-3-9-10-4-6-12(17)8(2)14(10)19-15(18)13(7)9/h3-6,17H,16H2,1-2H3.
What are the key properties of 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one?
8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one has a molecular weight of 255.27 g/mol, XLogP of 2.85, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-3-hydroxy-4,7-dimethylbenzo[c]chromen-6-one is sourced from PubChem (CID 10060912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).