C14H27NO3 — CID 10061030
tert-butyl N-[(3S,4R,5S)-4-hydroxy-2,5-dimethylhept-6-en-3-yl]carbamate (PubChem CID 10061030) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R,5S)-4-hydroxy-2,5-dimethylhept-6-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R,5S)-4-hydroxy-2,5-dimethylhept-6-en-3-yl]carbamate |
|---|---|
| PubChem CID | 10061030 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | tert-butyl N-[(3S,4R,5S)-4-hydroxy-2,5-dimethylhept-6-en-3-yl]carbamate |
| SMILES | C=C[C@H](C)[C@@H](O)[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C14H27NO3/c1-8-10(4)12(16)11(9(2)3)15-13(17)18-14(5,6)7/h8-12,16H,1H2,2-7H3,(H,15,17)/t10-,11-,12+/m0/s1 |
| InChIKey | NNECBFOOVHKSDU-SDDRHHMPSA-N |
| XLogP | 2.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|