About 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol
2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol (PubChem CID 10061083) has the molecular formula C6H4S5
and a molecular weight of 236.43 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol.
Molecular Properties
| Compound Name | 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol |
| PubChem CID | 10061083 |
| Molecular Formula | C6H4S5 |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 235.89 |
| IUPAC Name | 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol |
| SMILES | SC1=CSC(=C2SC=CS2)S1 |
| InChI | InChI=1S/C6H4S5/c7-4-3-10-6(11-4)5-8-1-2-9-5/h1-3,7H |
| InChIKey | IJKYWVQKBRCFBZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol?
The IUPAC name of 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol (CID 10061083) is 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol.
What is the SMILES notation for 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol?
The canonical SMILES for 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol is SC1=CSC(=C2SC=CS2)S1.
What is the InChIKey of 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol?
The InChIKey is IJKYWVQKBRCFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4S5/c7-4-3-10-6(11-4)5-8-1-2-9-5/h1-3,7H.
What are the key properties of 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol?
2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol has a molecular weight of 236.43 g/mol, XLogP of 4.27, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dithiol-2-ylidene)-1,3-dithiole-4-thiol is sourced from PubChem (CID 10061083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).