About 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine
2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine (PubChem CID 100610919) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine.
Molecular Properties
| Compound Name | 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine |
| PubChem CID | 100610919 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine |
| SMILES | Cc1cnc(Cn2cnc(C)c2C)cn1 |
| InChI | InChI=1S/C11H14N4/c1-8-4-13-11(5-12-8)6-15-7-14-9(2)10(15)3/h4-5,7H,6H2,1-3H3 |
| InChIKey | HMVNFIYASKCQEY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine?
The IUPAC name of 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine (CID 100610919) is 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine.
What is the SMILES notation for 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine?
The canonical SMILES for 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine is Cc1cnc(Cn2cnc(C)c2C)cn1.
What is the InChIKey of 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine?
The InChIKey is HMVNFIYASKCQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4/c1-8-4-13-11(5-12-8)6-15-7-14-9(2)10(15)3/h4-5,7H,6H2,1-3H3.
What are the key properties of 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine?
2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine has a molecular weight of 202.26 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylpyrazine is sourced from PubChem (CID 100610919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).