C17H21N3O6 — CID 100611557
methyl 2-[(7R,8aS)-1'-(furan-3-ylmethyl)-7-hydroxy-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate (PubChem CID 100611557) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is methyl 2-[(7R,8aS)-1'-(furan-3-ylmethyl)-7-hydroxy-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate.
| Compound Name | methyl 2-[(7R,8aS)-1'-(furan-3-ylmethyl)-7-hydroxy-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate |
|---|---|
| PubChem CID | 100611557 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | methyl 2-[(7R,8aS)-1'-(furan-3-ylmethyl)-7-hydroxy-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate |
| SMILES | COC(=O)CN1C(=O)[C@@H]2C[C@@H](O)CN2C2(CN(Cc3ccoc3)C2)C1=O |
| InChI | InChI=1S/C17H21N3O6/c1-25-14(22)7-19-15(23)13-4-12(21)6-20(13)17(16(19)24)9-18(10-17)5-11-2-3-26-8-11/h2-3,8,12-13,21H,4-7,9-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | HNNKPBWQTNHTOS-OLZOCXBDSA-N |
| XLogP | -1.19 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|