C33H42ClN3O4S — CID 100611754
N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-chlorophenyl)methyl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 100611754) has the molecular formula C33H42ClN3O4S and a molecular weight of 612.24 g/mol. Its IUPAC name is N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-chlorophenyl)methyl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-chlorophenyl)methyl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100611754 |
| Molecular Formula | C33H42ClN3O4S |
| Molecular Weight | 612.24 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-chlorophenyl)methyl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CCCN(c1ccc(C)c(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C33H42ClN3O4S/c1-5-6-20-35-33(39)31(23-27-13-8-7-9-14-27)36(24-28-15-10-11-16-30(28)34)32(38)17-12-21-37(42(4,40)41)29-19-18-25(2)26(3)22-29/h7-11,13-16,18-19,22,31H,5-6,12,17,20-21,23-24H2,1-4H3,(H,35,39)/t31-/m0/s1 |
| InChIKey | DYNDHNXXFHZMLP-HKBQPEDESA-N |
| XLogP | 6.06 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.24 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|