C18H28O — CID 10061183
(1S,2S,4R)-3,3-dimethyl-2-[(5R)-5-propan-2-ylcyclopenten-1-yl]bicyclo[2.2.2]oct-5-en-2-ol (PubChem CID 10061183) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (1S,2S,4R)-3,3-dimethyl-2-[(5R)-5-propan-2-ylcyclopenten-1-yl]bicyclo[2.2.2]oct-5-en-2-ol.
| Compound Name | (1S,2S,4R)-3,3-dimethyl-2-[(5R)-5-propan-2-ylcyclopenten-1-yl]bicyclo[2.2.2]oct-5-en-2-ol |
|---|---|
| PubChem CID | 10061183 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (1S,2S,4R)-3,3-dimethyl-2-[(5R)-5-propan-2-ylcyclopenten-1-yl]bicyclo[2.2.2]oct-5-en-2-ol |
| SMILES | CC(C)[C@H]1CCC=C1[C@]1(O)[C@@H]2C=C[C@@H](CC2)C1(C)C |
| InChI | InChI=1S/C18H28O/c1-12(2)15-6-5-7-16(15)18(19)14-10-8-13(9-11-14)17(18,3)4/h7-8,10,12-15,19H,5-6,9,11H2,1-4H3/t13-,14+,15+,18+/m0/s1 |
| InChIKey | PWQDONGETJODLL-LUXYFRNMSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|