About 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine
3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine (PubChem CID 100611868) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine.
Molecular Properties
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine |
| PubChem CID | 100611868 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine |
| SMILES | C/N=C(/NCCC1=CCCCC1)N(C)C |
| InChI | InChI=1S/C12H23N3/c1-13-12(15(2)3)14-10-9-11-7-5-4-6-8-11/h7H,4-6,8-10H2,1-3H3,(H,13,14) |
| InChIKey | MWNDOYOXKRJLKH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine?
The IUPAC name of 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine (CID 100611868) is 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine.
What is the SMILES notation for 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine?
The canonical SMILES for 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine is C/N=C(/NCCC1=CCCCC1)N(C)C.
What is the InChIKey of 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine?
The InChIKey is MWNDOYOXKRJLKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3/c1-13-12(15(2)3)14-10-9-11-7-5-4-6-8-11/h7H,4-6,8-10H2,1-3H3,(H,13,14).
What are the key properties of 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine?
3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine has a molecular weight of 209.34 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(cyclohexen-1-yl)ethyl]-1,1,2-trimethylguanidine is sourced from PubChem (CID 100611868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).