About [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate
[(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate (PubChem CID 100612413) has the molecular formula C19H33NO3
and a molecular weight of 323.48 g/mol. Its IUPAC name is [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate |
| PubChem CID | 100612413 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate |
| SMILES | CCCCO[C@H]1C[C@H](OC(=O)C2CCN(C3CC3)CC2)C1(C)C |
| InChI | InChI=1S/C19H33NO3/c1-4-5-12-22-16-13-17(19(16,2)3)23-18(21)14-8-10-20(11-9-14)15-6-7-15/h14-17H,4-13H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | MZIBNLJKKZJNAR-IRXDYDNUSA-N |
| XLogP | 3.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate?
The IUPAC name of [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate (CID 100612413) is [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate.
What is the SMILES notation for [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate?
The canonical SMILES for [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate is CCCCO[C@H]1C[C@H](OC(=O)C2CCN(C3CC3)CC2)C1(C)C.
What is the InChIKey of [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate?
The InChIKey is MZIBNLJKKZJNAR-IRXDYDNUSA-N. The full InChI is InChI=1S/C19H33NO3/c1-4-5-12-22-16-13-17(19(16,2)3)23-18(21)14-8-10-20(11-9-14)15-6-7-15/h14-17H,4-13H2,1-3H3/t16-,17-/m0/s1.
What are the key properties of [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate?
[(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate has a molecular weight of 323.48 g/mol, XLogP of 3.39, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl] 1-cyclopropylpiperidine-4-carboxylate is sourced from PubChem (CID 100612413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).