About (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide
(2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide (PubChem CID 100612538) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide |
| PubChem CID | 100612538 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide |
| SMILES | C[C@H](O)[C@](C)(CNC(=O)[C@H]1CCCO1)Cc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-13(19)17(2,11-14-7-4-3-5-8-14)12-18-16(20)15-9-6-10-21-15/h3-5,7-8,13,15,19H,6,9-12H2,1-2H3,(H,18,20)/t13-,15+,17-/m0/s1 |
| InChIKey | BXIUEVQCBWSHKK-LXZKKBNFSA-N |
| XLogP | 1.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide?
The IUPAC name of (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide (CID 100612538) is (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide.
What is the SMILES notation for (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide?
The canonical SMILES for (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide is C[C@H](O)[C@](C)(CNC(=O)[C@H]1CCCO1)Cc1ccccc1.
What is the InChIKey of (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide?
The InChIKey is BXIUEVQCBWSHKK-LXZKKBNFSA-N. The full InChI is InChI=1S/C17H25NO3/c1-13(19)17(2,11-14-7-4-3-5-8-14)12-18-16(20)15-9-6-10-21-15/h3-5,7-8,13,15,19H,6,9-12H2,1-2H3,(H,18,20)/t13-,15+,17-/m0/s1.
What are the key properties of (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide?
(2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide has a molecular weight of 291.39 g/mol, XLogP of 1.91, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(2S,3S)-2-benzyl-3-hydroxy-2-methylbutyl]oxolane-2-carboxamide is sourced from PubChem (CID 100612538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).