C21H26FN3O3 — CID 100612709
(7R,8aS)-1'-cyclopentyl-2-[(2-fluorophenyl)methyl]-7-hydroxyspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione (PubChem CID 100612709) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is (7R,8aS)-1'-cyclopentyl-2-[(2-fluorophenyl)methyl]-7-hydroxyspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione.
| Compound Name | (7R,8aS)-1'-cyclopentyl-2-[(2-fluorophenyl)methyl]-7-hydroxyspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione |
|---|---|
| PubChem CID | 100612709 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (7R,8aS)-1'-cyclopentyl-2-[(2-fluorophenyl)methyl]-7-hydroxyspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione |
| SMILES | O=C1[C@@H]2C[C@@H](O)CN2C2(CN(C3CCCC3)C2)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C21H26FN3O3/c22-17-8-4-1-5-14(17)10-24-19(27)18-9-16(26)11-25(18)21(20(24)28)12-23(13-21)15-6-2-3-7-15/h1,4-5,8,15-16,18,26H,2-3,6-7,9-13H2/t16-,18+/m1/s1 |
| InChIKey | OTYPLBWCZUBTRD-AEFFLSMTSA-N |
| XLogP | 1.13 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|