C30H33FN2O2 — CID 100613191
(2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide (PubChem CID 100613191) has the molecular formula C30H33FN2O2 and a molecular weight of 472.60 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100613191 |
| Molecular Formula | C30H33FN2O2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C30H33FN2O2/c31-26-18-16-25(17-19-26)22-33(29(34)21-24-12-6-2-7-13-24)28(20-23-10-4-1-5-11-23)30(35)32-27-14-8-3-9-15-27/h1-2,4-7,10-13,16-19,27-28H,3,8-9,14-15,20-22H2,(H,32,35)/t28-/m1/s1 |
| InChIKey | LRMWBLNCCVLRHT-MUUNZHRXSA-N |
| XLogP | 5.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |