About (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate
(1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate (PubChem CID 100613228) has the molecular formula C16H18N6O2
and a molecular weight of 326.36 g/mol. Its IUPAC name is (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate.
Molecular Properties
| Compound Name | (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate |
| PubChem CID | 100613228 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate |
| SMILES | CC(C)(C)n1cc(C(=O)OCc2ncn(-c3ccccc3)n2)nn1 |
| InChI | InChI=1S/C16H18N6O2/c1-16(2,3)22-9-13(18-20-22)15(23)24-10-14-17-11-21(19-14)12-7-5-4-6-8-12/h4-9,11H,10H2,1-3H3 |
| InChIKey | CROKLWFGVLZGGH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate?
The IUPAC name of (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate (CID 100613228) is (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate.
What is the SMILES notation for (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate?
The canonical SMILES for (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate is CC(C)(C)n1cc(C(=O)OCc2ncn(-c3ccccc3)n2)nn1.
What is the InChIKey of (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate?
The InChIKey is CROKLWFGVLZGGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N6O2/c1-16(2,3)22-9-13(18-20-22)15(23)24-10-14-17-11-21(19-14)12-7-5-4-6-8-12/h4-9,11H,10H2,1-3H3.
What are the key properties of (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate?
(1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate has a molecular weight of 326.36 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenyl-1,2,4-triazol-3-yl)methyl 1-tert-butyltriazole-4-carboxylate is sourced from PubChem (CID 100613228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).