C11H16BrNO2 — CID 100614298
N-[(5-bromofuran-2-yl)methyl]-N-(2-methoxyethyl)cyclopropanamine (PubChem CID 100614298) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)methyl]-N-(2-methoxyethyl)cyclopropanamine.
| Compound Name | N-[(5-bromofuran-2-yl)methyl]-N-(2-methoxyethyl)cyclopropanamine |
|---|---|
| PubChem CID | 100614298 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-[(5-bromofuran-2-yl)methyl]-N-(2-methoxyethyl)cyclopropanamine |
| SMILES | COCCN(Cc1ccc(Br)o1)C1CC1 |
| InChI | InChI=1S/C11H16BrNO2/c1-14-7-6-13(9-2-3-9)8-10-4-5-11(12)15-10/h4-5,9H,2-3,6-8H2,1H3 |
| InChIKey | KFGFXGUSDWCVIO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |