C17H20N2O4S — CID 100614354
[4-(ethylcarbamoyl)phenyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 100614354) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is [4-(ethylcarbamoyl)phenyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [4-(ethylcarbamoyl)phenyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 100614354 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [4-(ethylcarbamoyl)phenyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CCNC(=O)c1ccc(OC(=O)[C@H]2CS[C@@]3(C)CCC(=O)N23)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-3-18-15(21)11-4-6-12(7-5-11)23-16(22)13-10-24-17(2)9-8-14(20)19(13)17/h4-7,13H,3,8-10H2,1-2H3,(H,18,21)/t13-,17+/m1/s1 |
| InChIKey | MONJJVWQJDQYOA-DYVFJYSZSA-N |
| XLogP | 1.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|