C27H26FN5O2S2 — CID 100614471
N-[4-[(4R,5S)-5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide (PubChem CID 100614471) has the molecular formula C27H26FN5O2S2 and a molecular weight of 535.67 g/mol. Its IUPAC name is N-[4-[(4R,5S)-5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(4R,5S)-5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100614471 |
| Molecular Formula | C27H26FN5O2S2 |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | N-[4-[(4R,5S)-5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
| SMILES | Cc1cc([C@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(NS(C)(=O)=O)cc2)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C27H26FN5O2S2/c1-17-16-21(18(2)32(17)24-10-5-4-8-22(24)28)26-25(23-9-6-7-15-29-23)30-27(36)33(26)20-13-11-19(12-14-20)31-37(3,34)35/h4-16,25-26,31H,1-3H3,(H,30,36)/t25-,26-/m0/s1 |
| InChIKey | GDSUAZIOESBHMT-UIOOFZCWSA-N |
| XLogP | 5.18 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|