C16H26O3 — CID 10061469
(3aS,4R,7S,7aR)-7-(cyclohexylmethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 10061469) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (3aS,4R,7S,7aR)-7-(cyclohexylmethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4R,7S,7aR)-7-(cyclohexylmethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 10061469 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (3aS,4R,7S,7aR)-7-(cyclohexylmethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CC1CCCCC1)C=C[C@H]2O |
| InChI | InChI=1S/C16H26O3/c1-16(2)18-14-12(8-9-13(17)15(14)19-16)10-11-6-4-3-5-7-11/h8-9,11-15,17H,3-7,10H2,1-2H3/t12-,13-,14-,15+/m1/s1 |
| InChIKey | QXSNDJRCNKHSSA-TUVASFSCSA-N |
| XLogP | 3.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|