C14H15BrN4O3S — CID 100615430
4-[[(3R)-1-(5-bromo-3-nitro-2-pyridinyl)pyrrolidin-3-yl]oxymethyl]-2-methyl-1,3-thiazole (PubChem CID 100615430) has the molecular formula C14H15BrN4O3S and a molecular weight of 399.27 g/mol. Its IUPAC name is 4-[[(3R)-1-(5-bromo-3-nitro-2-pyridinyl)pyrrolidin-3-yl]oxymethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[(3R)-1-(5-bromo-3-nitro-2-pyridinyl)pyrrolidin-3-yl]oxymethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 100615430 |
| Molecular Formula | C14H15BrN4O3S |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 4-[[(3R)-1-(5-bromo-3-nitro-2-pyridinyl)pyrrolidin-3-yl]oxymethyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(CO[C@@H]2CCN(c3ncc(Br)cc3[N+](=O)[O-])C2)cs1 |
| InChI | InChI=1S/C14H15BrN4O3S/c1-9-17-11(8-23-9)7-22-12-2-3-18(6-12)14-13(19(20)21)4-10(15)5-16-14/h4-5,8,12H,2-3,6-7H2,1H3/t12-/m1/s1 |
| InChIKey | ARPWXELPTXWBPX-GFCCVEGCSA-N |
| XLogP | 3.31 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|