About cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate
cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate (PubChem CID 100615598) has the molecular formula C11H16N2O2S
and a molecular weight of 240.33 g/mol. Its IUPAC name is cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate |
| PubChem CID | 100615598 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC[C@@H]1NCc1cncs1 |
| InChI | InChI=1S/C11H16N2O2S/c1-15-11(14)9-3-2-4-10(9)13-6-8-5-12-7-16-8/h5,7,9-10,13H,2-4,6H2,1H3/t9-,10+/m1/s1 |
| InChIKey | BGPNEJHQFYHRGZ-ZJUUUORDSA-N |
| XLogP | 1.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate?
The IUPAC name of cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate (CID 100615598) is cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate.
What is the SMILES notation for cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate?
The canonical SMILES for cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate is COC(=O)[C@@H]1CCC[C@@H]1NCc1cncs1.
What is the InChIKey of cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate?
The InChIKey is BGPNEJHQFYHRGZ-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-15-11(14)9-3-2-4-10(9)13-6-8-5-12-7-16-8/h5,7,9-10,13H,2-4,6H2,1H3/t9-,10+/m1/s1.
What are the key properties of cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate?
cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate has a molecular weight of 240.33 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1R,2S)-2-(1,3-thiazol-5-ylmethylamino)cyclopentane-1-carboxylate is sourced from PubChem (CID 100615598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).