C20H23N3O5 — CID 100615775
(7R,8aS)-1'-(furan-3-ylmethyl)-7-hydroxy-2-[(5-methylfuran-2-yl)methyl]spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione (PubChem CID 100615775) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is (7R,8aS)-1'-(furan-3-ylmethyl)-7-hydroxy-2-[(5-methylfuran-2-yl)methyl]spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione.
| Compound Name | (7R,8aS)-1'-(furan-3-ylmethyl)-7-hydroxy-2-[(5-methylfuran-2-yl)methyl]spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione |
|---|---|
| PubChem CID | 100615775 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (7R,8aS)-1'-(furan-3-ylmethyl)-7-hydroxy-2-[(5-methylfuran-2-yl)methyl]spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione |
| SMILES | Cc1ccc(CN2C(=O)[C@@H]3C[C@@H](O)CN3C3(CN(Cc4ccoc4)C3)C2=O)o1 |
| InChI | InChI=1S/C20H23N3O5/c1-13-2-3-16(28-13)9-22-18(25)17-6-15(24)8-23(17)20(19(22)26)11-21(12-20)7-14-4-5-27-10-14/h2-5,10,15,17,24H,6-9,11-12H2,1H3/t15-,17+/m1/s1 |
| InChIKey | KJYVEAMDTBFFAE-WBVHZDCISA-N |
| XLogP | 0.74 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|