C13H15F2NO3 — CID 10061732
methyl (3S)-3-acetamido-2,2-difluoro-4-phenylbutanoate (PubChem CID 10061732) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is methyl (3S)-3-acetamido-2,2-difluoro-4-phenylbutanoate.
| Compound Name | methyl (3S)-3-acetamido-2,2-difluoro-4-phenylbutanoate |
|---|---|
| PubChem CID | 10061732 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methyl (3S)-3-acetamido-2,2-difluoro-4-phenylbutanoate |
| SMILES | COC(=O)C(F)(F)[C@H](Cc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C13H15F2NO3/c1-9(17)16-11(13(14,15)12(18)19-2)8-10-6-4-3-5-7-10/h3-7,11H,8H2,1-2H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | FCBGRBIIOITPOW-NSHDSACASA-N |
| XLogP | 1.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |