C26H28N2O4S2 — CID 100617845
3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-N-(2-phenylsulfanylphenyl)propanamide (PubChem CID 100617845) has the molecular formula C26H28N2O4S2 and a molecular weight of 496.65 g/mol. Its IUPAC name is 3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-N-(2-phenylsulfanylphenyl)propanamide.
| Compound Name | 3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-N-(2-phenylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 100617845 |
| Molecular Formula | C26H28N2O4S2 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-N-(2-phenylsulfanylphenyl)propanamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1CCC(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C26H28N2O4S2/c1-32-24-15-14-22(34(30,31)28-17-7-8-18-28)19-20(24)13-16-26(29)27-23-11-5-6-12-25(23)33-21-9-3-2-4-10-21/h2-6,9-12,14-15,19H,7-8,13,16-18H2,1H3,(H,27,29) |
| InChIKey | APHXTVQAFWNMFN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |