About N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide (PubChem CID 100617931) has the molecular formula C15H19Cl2NOS
and a molecular weight of 332.30 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide |
| PubChem CID | 100617931 |
| Molecular Formula | C15H19Cl2NOS |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide |
| SMILES | O=C(NCCSCc1c(Cl)cccc1Cl)C1CCCC1 |
| InChI | InChI=1S/C15H19Cl2NOS/c16-13-6-3-7-14(17)12(13)10-20-9-8-18-15(19)11-4-1-2-5-11/h3,6-7,11H,1-2,4-5,8-10H2,(H,18,19) |
| InChIKey | WDIKYMFCAASWSA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide?
The IUPAC name of N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide (CID 100617931) is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide.
What is the SMILES notation for N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide?
The canonical SMILES for N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide is O=C(NCCSCc1c(Cl)cccc1Cl)C1CCCC1.
What is the InChIKey of N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide?
The InChIKey is WDIKYMFCAASWSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2NOS/c16-13-6-3-7-14(17)12(13)10-20-9-8-18-15(19)11-4-1-2-5-11/h3,6-7,11H,1-2,4-5,8-10H2,(H,18,19).
What are the key properties of N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide?
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide has a molecular weight of 332.30 g/mol, XLogP of 4.53, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide is sourced from PubChem (CID 100617931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).