About [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate
[(Z)-1-phenylbut-2-enyl] N-phenylcarbamate (PubChem CID 10061826) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate |
| PubChem CID | 10061826 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate |
| SMILES | C/C=C\C(OC(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c1-2-9-16(14-10-5-3-6-11-14)20-17(19)18-15-12-7-4-8-13-15/h2-13,16H,1H3,(H,18,19)/b9-2- |
| InChIKey | IQHXHKGUGNGGJU-MBXJOHMKSA-N |
| XLogP | 4.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate?
The IUPAC name of [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate (CID 10061826) is [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate.
What is the SMILES notation for [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate?
The canonical SMILES for [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate is C/C=C\C(OC(=O)Nc1ccccc1)c1ccccc1.
What is the InChIKey of [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate?
The InChIKey is IQHXHKGUGNGGJU-MBXJOHMKSA-N. The full InChI is InChI=1S/C17H17NO2/c1-2-9-16(14-10-5-3-6-11-14)20-17(19)18-15-12-7-4-8-13-15/h2-13,16H,1H3,(H,18,19)/b9-2-.
What are the key properties of [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate?
[(Z)-1-phenylbut-2-enyl] N-phenylcarbamate has a molecular weight of 267.33 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1-phenylbut-2-enyl] N-phenylcarbamate is sourced from PubChem (CID 10061826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).