About N-(3,4-dimethoxyphenyl)benzenecarbothioamide
N-(3,4-dimethoxyphenyl)benzenecarbothioamide (PubChem CID 10061849) has the molecular formula C15H15NO2S
and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)benzenecarbothioamide.
Molecular Properties
| Compound Name | N-(3,4-dimethoxyphenyl)benzenecarbothioamide |
| PubChem CID | 10061849 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)benzenecarbothioamide |
| SMILES | COc1ccc(NC(=S)c2ccccc2)cc1OC |
| InChI | InChI=1S/C15H15NO2S/c1-17-13-9-8-12(10-14(13)18-2)16-15(19)11-6-4-3-5-7-11/h3-10H,1-2H3,(H,16,19) |
| InChIKey | SGUWIDRINDXTGN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dimethoxyphenyl)benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethoxyphenyl)benzenecarbothioamide?
The IUPAC name of N-(3,4-dimethoxyphenyl)benzenecarbothioamide (CID 10061849) is N-(3,4-dimethoxyphenyl)benzenecarbothioamide.
What is the SMILES notation for N-(3,4-dimethoxyphenyl)benzenecarbothioamide?
The canonical SMILES for N-(3,4-dimethoxyphenyl)benzenecarbothioamide is COc1ccc(NC(=S)c2ccccc2)cc1OC.
What is the InChIKey of N-(3,4-dimethoxyphenyl)benzenecarbothioamide?
The InChIKey is SGUWIDRINDXTGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2S/c1-17-13-9-8-12(10-14(13)18-2)16-15(19)11-6-4-3-5-7-11/h3-10H,1-2H3,(H,16,19).
What are the key properties of N-(3,4-dimethoxyphenyl)benzenecarbothioamide?
N-(3,4-dimethoxyphenyl)benzenecarbothioamide has a molecular weight of 273.36 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethoxyphenyl)benzenecarbothioamide is sourced from PubChem (CID 10061849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).