About 9-phenyl-9H-thioxanthene
9-phenyl-9H-thioxanthene (PubChem CID 10061919) has the molecular formula C19H14S
and a molecular weight of 274.39 g/mol. Its IUPAC name is 9-phenyl-9H-thioxanthene.
Molecular Properties
| Compound Name | 9-phenyl-9H-thioxanthene |
| PubChem CID | 10061919 |
| Molecular Formula | C19H14S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 9-phenyl-9H-thioxanthene |
| SMILES | c1ccc(C2c3ccccc3Sc3ccccc32)cc1 |
| InChI | InChI=1S/C19H14S/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13,19H |
| InChIKey | HIWIIHPKFGJZSX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-phenyl-9H-thioxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenyl-9H-thioxanthene?
The IUPAC name of 9-phenyl-9H-thioxanthene (CID 10061919) is 9-phenyl-9H-thioxanthene.
What is the SMILES notation for 9-phenyl-9H-thioxanthene?
The canonical SMILES for 9-phenyl-9H-thioxanthene is c1ccc(C2c3ccccc3Sc3ccccc32)cc1.
What is the InChIKey of 9-phenyl-9H-thioxanthene?
The InChIKey is HIWIIHPKFGJZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14S/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13,19H.
What are the key properties of 9-phenyl-9H-thioxanthene?
9-phenyl-9H-thioxanthene has a molecular weight of 274.39 g/mol, XLogP of 5.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenyl-9H-thioxanthene is sourced from PubChem (CID 10061919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).