C15H14ClN5O2 — CID 100619755
1-(3-chloro-4-hydroxyphenyl)-3-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)urea (PubChem CID 100619755) has the molecular formula C15H14ClN5O2 and a molecular weight of 331.76 g/mol. Its IUPAC name is 1-(3-chloro-4-hydroxyphenyl)-3-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)urea.
| Compound Name | 1-(3-chloro-4-hydroxyphenyl)-3-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)urea |
|---|---|
| PubChem CID | 100619755 |
| Molecular Formula | C15H14ClN5O2 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-(3-chloro-4-hydroxyphenyl)-3-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)urea |
| SMILES | Cc1nn(C)c2ncc(NC(=O)Nc3ccc(O)c(Cl)c3)cc12 |
| InChI | InChI=1S/C15H14ClN5O2/c1-8-11-5-10(7-17-14(11)21(2)20-8)19-15(23)18-9-3-4-13(22)12(16)6-9/h3-7,22H,1-2H3,(H2,18,19,23) |
| InChIKey | OTTSPJGSZNHPMN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|