C19H20ClFN2O3 — CID 100620282
(2S)-2-[(3-chlorophenyl)methyl-[2-(2-fluorophenoxy)acetyl]amino]-N-methylpropanamide (PubChem CID 100620282) has the molecular formula C19H20ClFN2O3 and a molecular weight of 378.83 g/mol. Its IUPAC name is (2S)-2-[(3-chlorophenyl)methyl-[2-(2-fluorophenoxy)acetyl]amino]-N-methylpropanamide.
| Compound Name | (2S)-2-[(3-chlorophenyl)methyl-[2-(2-fluorophenoxy)acetyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 100620282 |
| Molecular Formula | C19H20ClFN2O3 |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (2S)-2-[(3-chlorophenyl)methyl-[2-(2-fluorophenoxy)acetyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](C)N(Cc1cccc(Cl)c1)C(=O)COc1ccccc1F |
| InChI | InChI=1S/C19H20ClFN2O3/c1-13(19(25)22-2)23(11-14-6-5-7-15(20)10-14)18(24)12-26-17-9-4-3-8-16(17)21/h3-10,13H,11-12H2,1-2H3,(H,22,25)/t13-/m0/s1 |
| InChIKey | WRQCCYHFOBUDSQ-ZDUSSCGKSA-N |
| XLogP | 3.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |