About methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate
methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate (PubChem CID 10062102) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate |
| PubChem CID | 10062102 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate |
| SMILES | COC(=O)c1cc2n(c1CCCCNC(C)=O)CCC2 |
| InChI | InChI=1S/C15H22N2O3/c1-11(18)16-8-4-3-7-14-13(15(19)20-2)10-12-6-5-9-17(12)14/h10H,3-9H2,1-2H3,(H,16,18) |
| InChIKey | VXFIXMKVVNGGGB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate?
The IUPAC name of methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate (CID 10062102) is methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate.
What is the SMILES notation for methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate?
The canonical SMILES for methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate is COC(=O)c1cc2n(c1CCCCNC(C)=O)CCC2.
What is the InChIKey of methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate?
The InChIKey is VXFIXMKVVNGGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-11(18)16-8-4-3-7-14-13(15(19)20-2)10-12-6-5-9-17(12)14/h10H,3-9H2,1-2H3,(H,16,18).
What are the key properties of methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate?
methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate has a molecular weight of 278.35 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-acetamidobutyl)-6,7-dihydro-5H-pyrrolizine-2-carboxylate is sourced from PubChem (CID 10062102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).