C18H23F4NO — CID 100621949
(1S,10S)-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-amine (PubChem CID 100621949) has the molecular formula C18H23F4NO and a molecular weight of 345.38 g/mol. Its IUPAC name is (1S,10S)-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-amine.
| Compound Name | (1S,10S)-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-amine |
|---|---|
| PubChem CID | 100621949 |
| Molecular Formula | C18H23F4NO |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (1S,10S)-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-amine |
| SMILES | FC(F)C(F)(F)COCCNC1[C@H]2CC[C@H]1Cc1ccccc1C2 |
| InChI | InChI=1S/C18H23F4NO/c19-17(20)18(21,22)11-24-8-7-23-16-14-5-6-15(16)10-13-4-2-1-3-12(13)9-14/h1-4,14-17,23H,5-11H2/t14-,15-/m0/s1 |
| InChIKey | DUCOTCLGRFXKOO-GJZGRUSLSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|