C17H19N3O — CID 10062265
N-benzyl-2-(5-phenyl-2,5-dihydro-1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 10062265) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-benzyl-2-(5-phenyl-2,5-dihydro-1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-benzyl-2-(5-phenyl-2,5-dihydro-1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 10062265 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-benzyl-2-(5-phenyl-2,5-dihydro-1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | c1ccc(CNCCC2=NC(c3ccccc3)ON2)cc1 |
| InChI | InChI=1S/C17H19N3O/c1-3-7-14(8-4-1)13-18-12-11-16-19-17(21-20-16)15-9-5-2-6-10-15/h1-10,17-18H,11-13H2,(H,19,20) |
| InChIKey | GHVCGRGNOAAINP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|